C25H24N2O3 — CID 91423053
(1S,22R)-17-methoxy-5-methyl-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaen-2-ol (PubChem CID 91423053) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is (1S,22R)-17-methoxy-5-methyl-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaen-2-ol.
| Compound Name | (1S,22R)-17-methoxy-5-methyl-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaen-2-ol |
|---|---|
| PubChem CID | 91423053 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (1S,22R)-17-methoxy-5-methyl-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaen-2-ol |
| SMILES | COc1ccc2c3c1OC1c4nc5ccccc5c(C)c4CC4(O)[C@@H](C2)NCC[C@]314 |
| InChI | InChI=1S/C25H24N2O3/c1-13-15-5-3-4-6-17(15)27-21-16(13)12-25(28)19-11-14-7-8-18(29-2)22-20(14)24(25,9-10-26-19)23(21)30-22/h3-8,19,23,26,28H,9-12H2,1-2H3/t19-,23?,24+,25?/m1/s1 |
| InChIKey | UIGXBIBYTZRERH-GBSWYXOSSA-N |
| XLogP | 3.13 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |