C24H20N2O5 — CID 136610121
(1S)-2,17-dihydroxy-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-5-carboxylic acid (PubChem CID 136610121) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is (1S)-2,17-dihydroxy-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-5-carboxylic acid.
| Compound Name | (1S)-2,17-dihydroxy-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-5-carboxylic acid |
|---|---|
| PubChem CID | 136610121 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (1S)-2,17-dihydroxy-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-5-carboxylic acid |
| SMILES | O=C(O)c1c2c(nc3ccccc13)C1Oc3c(O)ccc4c3[C@@]13CCNC(C4)C3(O)C2 |
| InChI | InChI=1S/C24H20N2O5/c27-15-6-5-11-9-16-24(30)10-13-17(22(28)29)12-3-1-2-4-14(12)26-19(13)21-23(24,7-8-25-16)18(11)20(15)31-21/h1-6,16,21,25,27,30H,7-10H2,(H,28,29)/t16?,21?,23-,24?/m0/s1 |
| InChIKey | FOWVLLYJZJDFGE-XZDNSCGYSA-N |
| XLogP | 2.22 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |