C18H18N2O3 — CID 57121238
10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaene-2,12-diol (PubChem CID 57121238) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaene-2,12-diol.
| Compound Name | 10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaene-2,12-diol |
|---|---|
| PubChem CID | 57121238 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 10-oxa-7,18-diazahexacyclo[9.9.1.01,9.02,17.04,8.015,21]henicosa-4(8),5,11,13,15(21)-pentaene-2,12-diol |
| SMILES | Oc1ccc2c3c1OC1c4[nH]ccc4CC4(O)C(C2)NCCC314 |
| InChI | InChI=1S/C18H18N2O3/c21-11-2-1-9-7-12-18(22)8-10-3-5-20-14(10)16-17(18,4-6-19-12)13(9)15(11)23-16/h1-3,5,12,16,19-22H,4,6-8H2 |
| InChIKey | OOPJLFQNGBNHCD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |