C26H28N2O3 — CID 90782358
ethane;(1S,2S,14R,22R)-5-methyl-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-2,17-diol (PubChem CID 90782358) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is ethane;(1S,2S,14R,22R)-5-methyl-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-2,17-diol.
| Compound Name | ethane;(1S,2S,14R,22R)-5-methyl-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-2,17-diol |
|---|---|
| PubChem CID | 90782358 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | ethane;(1S,2S,14R,22R)-5-methyl-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-2,17-diol |
| SMILES | CC.Cc1c2c(nc3ccccc13)[C@@H]1Oc3c(O)ccc4c3[C@@]13CCN[C@H](C4)[C@]3(O)C2 |
| InChI | InChI=1S/C24H22N2O3.C2H6/c1-12-14-4-2-3-5-16(14)26-20-15(12)11-24(28)18-10-13-6-7-17(27)21-19(13)23(24,8-9-25-18)22(20)29-21;1-2/h2-7,18,22,25,27-28H,8-11H2,1H3;1-2H3/t18-,22+,23+,24-;/m1./s1 |
| InChIKey | PCFNIVAUOBFJFG-IIKZURRYSA-N |
| XLogP | 3.85 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |