C27H30N2O4 — CID 91381136
(1S,22R)-5,17-dimethoxy-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaen-2-ol;ethane (PubChem CID 91381136) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is (1S,22R)-5,17-dimethoxy-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaen-2-ol;ethane.
| Compound Name | (1S,22R)-5,17-dimethoxy-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaen-2-ol;ethane |
|---|---|
| PubChem CID | 91381136 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (1S,22R)-5,17-dimethoxy-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaen-2-ol;ethane |
| SMILES | CC.COc1ccc2c3c1OC1c4nc5ccccc5c(OC)c4CC4(O)[C@@H](C2)NCC[C@]314 |
| InChI | InChI=1S/C25H24N2O4.C2H6/c1-29-17-8-7-13-11-18-25(28)12-15-20(27-16-6-4-3-5-14(16)21(15)30-2)23-24(25,9-10-26-18)19(13)22(17)31-23;1-2/h3-8,18,23,26,28H,9-12H2,1-2H3;1-2H3/t18-,23?,24+,25?;/m1./s1 |
| InChIKey | NXWFRKIVXOMSIS-BRJAMQBFSA-N |
| XLogP | 3.85 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |