C24H23N3O3 — CID 91248886
(1S,22R)-5-(methylamino)-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-2,17-diol (PubChem CID 91248886) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is (1S,22R)-5-(methylamino)-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-2,17-diol.
| Compound Name | (1S,22R)-5-(methylamino)-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-2,17-diol |
|---|---|
| PubChem CID | 91248886 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (1S,22R)-5-(methylamino)-15-oxa-12,23-diazaheptacyclo[14.9.1.01,14.02,22.04,13.06,11.020,26]hexacosa-4,6,8,10,12,16,18,20(26)-octaene-2,17-diol |
| SMILES | CNc1c2c(nc3ccccc13)C1Oc3c(O)ccc4c3[C@@]13CCN[C@H](C4)C3(O)C2 |
| InChI | InChI=1S/C24H23N3O3/c1-25-19-13-4-2-3-5-15(13)27-20-14(19)11-24(29)17-10-12-6-7-16(28)21-18(12)23(24,8-9-26-17)22(20)30-21/h2-7,17,22,26,28-29H,8-11H2,1H3,(H,25,27)/t17-,22?,23+,24?/m1/s1 |
| InChIKey | MWHGJYNWSLDQTD-LQXRAYSOSA-N |
| XLogP | 2.56 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |