C28H41NO5Si — CID 44600349
(4'aS)-9'-[tert-butyl(dimethyl)silyl]oxy-3'-(cyclopropylmethyl)spiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol (PubChem CID 44600349) has the molecular formula C28H41NO5Si and a molecular weight of 499.72 g/mol. Its IUPAC name is (4'aS)-9'-[tert-butyl(dimethyl)silyl]oxy-3'-(cyclopropylmethyl)spiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol.
| Compound Name | (4'aS)-9'-[tert-butyl(dimethyl)silyl]oxy-3'-(cyclopropylmethyl)spiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
|---|---|
| PubChem CID | 44600349 |
| Molecular Formula | C28H41NO5Si |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | (4'aS)-9'-[tert-butyl(dimethyl)silyl]oxy-3'-(cyclopropylmethyl)spiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c3c1OC1C4(CC[C@@]5(O)C(C2)N(CC2CC2)CCC315)OCCO4 |
| InChI | InChI=1S/C28H41NO5Si/c1-25(2,3)35(4,5)34-20-9-8-19-16-21-27(30)10-11-28(31-14-15-32-28)24-26(27,22(19)23(20)33-24)12-13-29(21)17-18-6-7-18/h8-9,18,21,24,30H,6-7,10-17H2,1-5H3/t21?,24?,26?,27-/m1/s1 |
| InChIKey | CTIIBHABWCADBC-FXHKQXJISA-N |
| XLogP | 4.38 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|