C39H47NO5Si — CID 67155029
(4R,4aS,7aS,12bS)-9-[tert-butyl(diphenyl)silyl]oxy-3-(cyclopropylmethyl)-7-(1,3-dioxolan-2-yl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 67155029) has the molecular formula C39H47NO5Si and a molecular weight of 637.89 g/mol. Its IUPAC name is (4R,4aS,7aS,12bS)-9-[tert-butyl(diphenyl)silyl]oxy-3-(cyclopropylmethyl)-7-(1,3-dioxolan-2-yl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4R,4aS,7aS,12bS)-9-[tert-butyl(diphenyl)silyl]oxy-3-(cyclopropylmethyl)-7-(1,3-dioxolan-2-yl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 67155029 |
| Molecular Formula | C39H47NO5Si |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | (4R,4aS,7aS,12bS)-9-[tert-butyl(diphenyl)silyl]oxy-3-(cyclopropylmethyl)-7-(1,3-dioxolan-2-yl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | CC(C)(C)[Si](Oc1ccc2c3c1O[C@H]1C(C4OCCO4)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H47NO5Si/c1-37(2,3)46(28-10-6-4-7-11-28,29-12-8-5-9-13-29)45-31-17-16-27-24-32-39(41)19-18-30(36-42-22-23-43-36)35-38(39,33(27)34(31)44-35)20-21-40(32)25-26-14-15-26/h4-13,16-17,26,30,32,35-36,41H,14-15,18-25H2,1-3H3/t30?,32-,35+,38+,39-/m1/s1 |
| InChIKey | IRXJSYMNXJMDCY-WMPVWCJUSA-N |
| XLogP | 5.18 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|