C27H28N2O4 — CID 142536979
(1S,2S,6R,14R,15R)-N-benzyl-11,15-dihydroxy-N-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene-16-carboxamide (PubChem CID 142536979) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is (1S,2S,6R,14R,15R)-N-benzyl-11,15-dihydroxy-N-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene-16-carboxamide.
| Compound Name | (1S,2S,6R,14R,15R)-N-benzyl-11,15-dihydroxy-N-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene-16-carboxamide |
|---|---|
| PubChem CID | 142536979 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (1S,2S,6R,14R,15R)-N-benzyl-11,15-dihydroxy-N-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene-16-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1=C[C@@]23CC[C@]1(O)[C@@H]1Oc4c(O)ccc5c4[C@@]12CCN[C@@H]3C5 |
| InChI | InChI=1S/C27H28N2O4/c1-29(15-16-5-3-2-4-6-16)23(31)18-14-25-9-10-27(18,32)24-26(25)11-12-28-20(25)13-17-7-8-19(30)22(33-24)21(17)26/h2-8,14,20,24,28,30,32H,9-13,15H2,1H3/t20-,24-,25-,26+,27-/m1/s1 |
| InChIKey | DPOJGQVBETYRGX-XJVFGQNOSA-N |
| XLogP | 2.42 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |