C33H32N2O7 — CID 174286833
bis[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]methanone (PubChem CID 174286833) has the molecular formula C33H32N2O7 and a molecular weight of 568.63 g/mol. Its IUPAC name is bis[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]methanone.
| Compound Name | bis[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]methanone |
|---|---|
| PubChem CID | 174286833 |
| Molecular Formula | C33H32N2O7 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | bis[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]methanone |
| SMILES | O=C(c1cc(O)c2c3c1C[C@H]1NCC[C@]34[C@H]1C=C[C@H](O)[C@@H]4O2)c1cc(O)c2c3c1C[C@H]1NCC[C@]34[C@H]1C=C[C@H](O)[C@@H]4O2 |
| InChI | InChI=1S/C33H32N2O7/c36-21-3-1-17-19-9-13-15(11-23(38)28-25(13)32(17,5-7-34-19)30(21)41-28)27(40)16-12-24(39)29-26-14(16)10-20-18-2-4-22(37)31(42-29)33(18,26)6-8-35-20/h1-4,11-12,17-22,30-31,34-39H,5-10H2/t17-,18-,19+,20+,21-,22-,30-,31-,32-,33-/m0/s1 |
| InChIKey | JTKCPEPDUKOTJM-PKWUJZAGSA-N |
| XLogP | 1.26 |
| TPSA | 140.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|