C20H25NO6S — CID 170336659
3-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]propane-1-sulfonic acid (PubChem CID 170336659) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 170336659 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 3-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]propane-1-sulfonic acid |
| SMILES | CN1CC[C@]23c4c5c(CCCS(=O)(=O)O)cc(O)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C20H25NO6S/c1-21-7-6-20-13-4-5-15(22)19(20)27-18-16(23)9-11(3-2-8-28(24,25)26)12(17(18)20)10-14(13)21/h4-5,9,13-15,19,22-23H,2-3,6-8,10H2,1H3,(H,24,25,26)/t13-,14+,15-,19-,20-/m0/s1 |
| InChIKey | UZERXZLKQQKLJQ-WYIOCLOVSA-N |
| XLogP | 1.02 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|