C23H29NO9 — CID 67635216
(2R,3R,4S,5S,6R)-6-[[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 67635216) has the molecular formula C23H29NO9 and a molecular weight of 463.48 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-[[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-[[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 67635216 |
| Molecular Formula | C23H29NO9 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-[[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | CN1CC[C@]23c4c5c(OC[C@H]6O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]6O)cc(O)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C23H29NO9/c1-24-5-4-23-10-2-3-12(25)21(23)33-20-13(26)7-14(9(16(20)23)6-11(10)24)31-8-15-17(27)18(28)19(29)22(30)32-15/h2-3,7,10-12,15,17-19,21-22,25-30H,4-6,8H2,1H3/t10-,11+,12-,15+,17+,18-,19+,21-,22+,23-/m0/s1 |
| InChIKey | QKKWBAVFNHDEKY-PSWPQQNDSA-N |
| XLogP | -1.62 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|