C24H32NNaO4 — CID 174253293
sodium;3-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]-4-methylhexan-2-one;hydride (PubChem CID 174253293) has the molecular formula C24H32NNaO4 and a molecular weight of 421.51 g/mol. Its IUPAC name is sodium;3-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]-4-methylhexan-2-one;hydride.
| Compound Name | sodium;3-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]-4-methylhexan-2-one;hydride |
|---|---|
| PubChem CID | 174253293 |
| Molecular Formula | C24H32NNaO4 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | sodium;3-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]-4-methylhexan-2-one;hydride |
| SMILES | CCC(C)C(C(C)=O)c1cc(O)c2c3c1C[C@@H]1[C@@H]4C=C[C@H](O)[C@H](O2)[C@]34CCN1C.[H-].[Na+] |
| InChI | InChI=1S/C24H31NO4.Na.H/c1-5-12(2)20(13(3)26)14-11-19(28)22-21-15(14)10-17-16-6-7-18(27)23(29-22)24(16,21)8-9-25(17)4;;/h6-7,11-12,16-18,20,23,27-28H,5,8-10H2,1-4H3;;/q;+1;-1/t12?,16-,17+,18-,20?,23-,24-;;/m0../s1 |
| InChIKey | WOSIUVINCUPQAO-LDVDVDOGSA-N |
| XLogP | 0.03 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|