C36H40N2O4 — CID 174972841
1-[2-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]phenyl]-2-benzyl-2-(dimethylamino)butan-1-one (PubChem CID 174972841) has the molecular formula C36H40N2O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is 1-[2-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]phenyl]-2-benzyl-2-(dimethylamino)butan-1-one.
| Compound Name | 1-[2-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]phenyl]-2-benzyl-2-(dimethylamino)butan-1-one |
|---|---|
| PubChem CID | 174972841 |
| Molecular Formula | C36H40N2O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | 1-[2-[(4R,4aR,7S,7aR,12bS)-7,9-dihydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-11-yl]phenyl]-2-benzyl-2-(dimethylamino)butan-1-one |
| SMILES | CCC(Cc1ccccc1)(C(=O)c1ccccc1-c1cc(O)c2c3c1C[C@@H]1[C@@H]4C=C[C@H](O)[C@H](O2)[C@]34CCN1C)N(C)C |
| InChI | InChI=1S/C36H40N2O4/c1-5-35(37(2)3,21-22-11-7-6-8-12-22)33(41)24-14-10-9-13-23(24)25-20-30(40)32-31-26(25)19-28-27-15-16-29(39)34(42-32)36(27,31)17-18-38(28)4/h6-16,20,27-29,34,39-40H,5,17-19,21H2,1-4H3/t27-,28+,29-,34-,35?,36-/m0/s1 |
| InChIKey | JNBXHVROHRGXCX-FDDPALHJSA-N |
| XLogP | 5.00 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|