C17H19NO9S — CID 90024218
(4S,4aR,7S,7aR,12bS)-7,9,11-trihydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one;sulfuric acid (PubChem CID 90024218) has the molecular formula C17H19NO9S and a molecular weight of 413.40 g/mol. Its IUPAC name is (4S,4aR,7S,7aR,12bS)-7,9,11-trihydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one;sulfuric acid.
| Compound Name | (4S,4aR,7S,7aR,12bS)-7,9,11-trihydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one;sulfuric acid |
|---|---|
| PubChem CID | 90024218 |
| Molecular Formula | C17H19NO9S |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (4S,4aR,7S,7aR,12bS)-7,9,11-trihydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one;sulfuric acid |
| SMILES | CN1CC[C@@]23c4c5c(O)cc(O)c4C(=O)[C@@H]1[C@@H]2C=C[C@H](O)[C@@H]3O5.O=S(=O)(O)O |
| InChI | InChI=1S/C17H17NO5.H2O4S/c1-18-5-4-17-7-2-3-8(19)16(17)23-15-10(21)6-9(20)11(12(15)17)14(22)13(7)18;1-5(2,3)4/h2-3,6-8,13,16,19-21H,4-5H2,1H3;(H2,1,2,3,4)/t7-,8-,13-,16-,17-;/m0./s1 |
| InChIKey | DSPWSOWJDQDWDA-RXAURNGISA-N |
| XLogP | -0.11 |
| TPSA | 164.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|