C17H17NO6 — CID 21158690
(4S,4aR,7S,7aR,12bS)-7,9,10,11-tetrahydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one (PubChem CID 21158690) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is (4S,4aR,7S,7aR,12bS)-7,9,10,11-tetrahydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one.
| Compound Name | (4S,4aR,7S,7aR,12bS)-7,9,10,11-tetrahydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one |
|---|---|
| PubChem CID | 21158690 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (4S,4aR,7S,7aR,12bS)-7,9,10,11-tetrahydroxy-3-methyl-1,2,4,4a,7,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one |
| SMILES | CN1CC[C@@]23c4c5c(O)c(O)c(O)c4C(=O)[C@@H]1[C@@H]2C=C[C@H](O)[C@@H]3O5 |
| InChI | InChI=1S/C17H17NO6/c1-18-5-4-17-6-2-3-7(19)16(17)24-15-9(17)8(11(20)10(6)18)12(21)13(22)14(15)23/h2-3,6-7,10,16,19,21-23H,4-5H2,1H3/t6-,7-,10-,16-,17-/m0/s1 |
| InChIKey | XXCPBXGBFMNWRC-OMURYJMQSA-N |
| XLogP | 0.25 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|