C27H37NO5 — CID 144507582
cyclopropanecarboxamide;(13R,15R)-10,14-dimethoxy-15-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-triene-15-carbaldehyde;ethene (PubChem CID 144507582) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is cyclopropanecarboxamide;(13R,15R)-10,14-dimethoxy-15-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-triene-15-carbaldehyde;ethene.
| Compound Name | cyclopropanecarboxamide;(13R,15R)-10,14-dimethoxy-15-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-triene-15-carbaldehyde;ethene |
|---|---|
| PubChem CID | 144507582 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | cyclopropanecarboxamide;(13R,15R)-10,14-dimethoxy-15-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-triene-15-carbaldehyde;ethene |
| SMILES | C=C.COc1ccc2c3c1O[C@H]1C(OC)[C@](C)(C=O)CC4C(CCCC341)C2.NC(=O)C1CC1 |
| InChI | InChI=1S/C21H26O4.C4H7NO.C2H4/c1-20(11-22)10-14-12-5-4-8-21(14)16-13(9-12)6-7-15(23-2)17(16)25-19(21)18(20)24-3;5-4(6)3-1-2-3;1-2/h6-7,11-12,14,18-19H,4-5,8-10H2,1-3H3;3H,1-2H2,(H2,5,6);1-2H2/t12?,14?,18?,19-,20-,21?;;/m0../s1 |
| InChIKey | HUBQHYYLTJNVGK-BSSXMYHMSA-N |
| XLogP | 3.97 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|