C38H52N2O4 — CID 57000723
[(4R,4aR,7R,7aR,12bS)-3-[(2-hydroxycyclopropyl)methyl]-7-(10-phenyldecan-5-ylamino)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 57000723) has the molecular formula C38H52N2O4 and a molecular weight of 600.84 g/mol. Its IUPAC name is [(4R,4aR,7R,7aR,12bS)-3-[(2-hydroxycyclopropyl)methyl]-7-(10-phenyldecan-5-ylamino)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7R,7aR,12bS)-3-[(2-hydroxycyclopropyl)methyl]-7-(10-phenyldecan-5-ylamino)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 57000723 |
| Molecular Formula | C38H52N2O4 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | [(4R,4aR,7R,7aR,12bS)-3-[(2-hydroxycyclopropyl)methyl]-7-(10-phenyldecan-5-ylamino)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CCCCC(CCCCCc1ccccc1)N[C@@H]1CC[C@H]2[C@H]3Cc4ccc(OC(C)=O)c5c4[C@@]2(CCN3CC2CC2O)[C@H]1O5 |
| InChI | InChI=1S/C38H52N2O4/c1-3-4-14-29(15-10-6-9-13-26-11-7-5-8-12-26)39-31-18-17-30-32-22-27-16-19-34(43-25(2)41)36-35(27)38(30,37(31)44-36)20-21-40(32)24-28-23-33(28)42/h5,7-8,11-12,16,19,28-33,37,39,42H,3-4,6,9-10,13-15,17-18,20-24H2,1-2H3/t28?,29?,30-,31+,32+,33?,37-,38-/m0/s1 |
| InChIKey | KIPHTLKGPLODQD-OVQRBSGMSA-N |
| XLogP | 6.35 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|