C27H37NO4 — CID 91286002
7-ethyl-4a-ethynyl-6-(2-hydroxy-3,3-dimethylbutan-2-yl)-7-methoxy-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol (PubChem CID 91286002) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 7-ethyl-4a-ethynyl-6-(2-hydroxy-3,3-dimethylbutan-2-yl)-7-methoxy-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol.
| Compound Name | 7-ethyl-4a-ethynyl-6-(2-hydroxy-3,3-dimethylbutan-2-yl)-7-methoxy-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
|---|---|
| PubChem CID | 91286002 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 7-ethyl-4a-ethynyl-6-(2-hydroxy-3,3-dimethylbutan-2-yl)-7-methoxy-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
| SMILES | C#CC12CC(C(C)(O)C(C)(C)C)C(CC)(OC)C3Oc4c(O)ccc5c4C31CCNC2C5 |
| InChI | InChI=1S/C27H37NO4/c1-8-25-15-18(24(6,30)23(3,4)5)27(9-2,31-7)22-26(25)12-13-28-19(25)14-16-10-11-17(29)21(32-22)20(16)26/h1,10-11,18-19,22,28-30H,9,12-15H2,2-7H3 |
| InChIKey | NTYIREJJRZFRBY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|