C17H21N — CID 151616142
(1S,9R,10R)-3-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene (PubChem CID 151616142) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (1S,9R,10R)-3-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene.
| Compound Name | (1S,9R,10R)-3-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene |
|---|---|
| PubChem CID | 151616142 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (1S,9R,10R)-3-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene |
| SMILES | Cc1cccc2c1[C@@]13C=CCC[C@H]1[C@@H](C2)NCC3 |
| InChI | InChI=1S/C17H21N/c1-12-5-4-6-13-11-15-14-7-2-3-8-17(14,16(12)13)9-10-18-15/h3-6,8,14-15,18H,2,7,9-11H2,1H3/t14-,15+,17+/m0/s1 |
| InChIKey | QNNPWZYYMVKDGW-ZMSDIMECSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|