C32H33NO2 — CID 21457204
(1S,9S,10R)-4-methoxy-17-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,13-tetraen-3-ol (PubChem CID 21457204) has the molecular formula C32H33NO2 and a molecular weight of 463.62 g/mol. Its IUPAC name is (1S,9S,10R)-4-methoxy-17-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,13-tetraen-3-ol.
| Compound Name | (1S,9S,10R)-4-methoxy-17-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,13-tetraen-3-ol |
|---|---|
| PubChem CID | 21457204 |
| Molecular Formula | C32H33NO2 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (1S,9S,10R)-4-methoxy-17-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,13-tetraen-3-ol |
| SMILES | COc1ccc2c(c1O)[C@@]13C=CCC[C@H]1[C@H](C2)N(C1c2ccccc2CCc2ccccc21)CC3 |
| InChI | InChI=1S/C32H33NO2/c1-35-28-16-15-23-20-27-26-12-6-7-17-32(26,29(23)31(28)34)18-19-33(27)30-24-10-4-2-8-21(24)13-14-22-9-3-5-11-25(22)30/h2-5,7-11,15-17,26-27,30,34H,6,12-14,18-20H2,1H3/t26-,27-,32+/m0/s1 |
| InChIKey | YRSYJBLKSJWURK-KWHBQZNLSA-N |
| XLogP | 6.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|