C24H25NO5S — CID 15974072
(1R,9S,10R)-17-(benzenesulfonyl)-3,4-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,13-tetraen-12-one (PubChem CID 15974072) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is (1R,9S,10R)-17-(benzenesulfonyl)-3,4-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,13-tetraen-12-one.
| Compound Name | (1R,9S,10R)-17-(benzenesulfonyl)-3,4-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,13-tetraen-12-one |
|---|---|
| PubChem CID | 15974072 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (1R,9S,10R)-17-(benzenesulfonyl)-3,4-dimethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,13-tetraen-12-one |
| SMILES | COc1ccc2c(c1OC)[C@]13C=CC(=O)C[C@H]1[C@H](C2)N(S(=O)(=O)c1ccccc1)CC3 |
| InChI | InChI=1S/C24H25NO5S/c1-29-21-9-8-16-14-20-19-15-17(26)10-11-24(19,22(16)23(21)30-2)12-13-25(20)31(27,28)18-6-4-3-5-7-18/h3-11,19-20H,12-15H2,1-2H3/t19-,20-,24-/m0/s1 |
| InChIKey | YUXATOGHEUXWFY-SKPFHBQLSA-N |
| XLogP | 3.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |