C23H21NO6S — CID 46242811
1-(benzenesulfonyl)-4-(2,3-dimethoxyphenyl)-3-phenoxyazetidin-2-one (PubChem CID 46242811) has the molecular formula C23H21NO6S and a molecular weight of 439.49 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(2,3-dimethoxyphenyl)-3-phenoxyazetidin-2-one.
| Compound Name | 1-(benzenesulfonyl)-4-(2,3-dimethoxyphenyl)-3-phenoxyazetidin-2-one |
|---|---|
| PubChem CID | 46242811 |
| Molecular Formula | C23H21NO6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(2,3-dimethoxyphenyl)-3-phenoxyazetidin-2-one |
| SMILES | COc1cccc(C2C(Oc3ccccc3)C(=O)N2S(=O)(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C23H21NO6S/c1-28-19-15-9-14-18(21(19)29-2)20-22(30-16-10-5-3-6-11-16)23(25)24(20)31(26,27)17-12-7-4-8-13-17/h3-15,20,22H,1-2H3 |
| InChIKey | DGQMNWMDGAIFMD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |