C17H19BF3NO3 — CID 15981308
(1S,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-one;trifluoroborane (PubChem CID 15981308) has the molecular formula C17H19BF3NO3 and a molecular weight of 353.15 g/mol. Its IUPAC name is (1S,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-one;trifluoroborane.
| Compound Name | (1S,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-one;trifluoroborane |
|---|---|
| PubChem CID | 15981308 |
| Molecular Formula | C17H19BF3NO3 |
| Molecular Weight | 353.15 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (1S,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-one;trifluoroborane |
| SMILES | COc1ccc2c3c1O[C@H]1CC(=O)C=C[C@@]31CCN(C)C2.FB(F)F |
| InChI | InChI=1S/C17H19NO3.BF3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17;2-1(3)4/h3-6,14H,7-10H2,1-2H3;/t14-,17-;/m0./s1 |
| InChIKey | GDZCOKCZQBSFRQ-RVXRQPKJSA-N |
| XLogP | 2.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|