C17H20NO5S- — CID 59825485
[(1R,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] sulfite (PubChem CID 59825485) has the molecular formula C17H20NO5S- and a molecular weight of 350.42 g/mol. Its IUPAC name is [(1R,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] sulfite.
| Compound Name | [(1R,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] sulfite |
|---|---|
| PubChem CID | 59825485 |
| Molecular Formula | C17H20NO5S- |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [(1R,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] sulfite |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](OS(=O)[O-])C=C[C@]31CCN(C)C2 |
| InChI | InChI=1S/C17H21NO5S/c1-18-8-7-17-6-5-12(23-24(19)20)9-14(17)22-16-13(21-2)4-3-11(10-18)15(16)17/h3-6,12,14H,7-10H2,1-2H3,(H,19,20)/p-1/t12-,14-,17+/m0/s1 |
| InChIKey | FWMKPNFILXXSOB-RVSPLBMKSA-M |
| XLogP | 1.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|