C22H30N2O4 — CID 70368425
[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] 2-amino-3-methylbutanoate (PubChem CID 70368425) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is [(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] 2-amino-3-methylbutanoate.
| Compound Name | [(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 70368425 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] 2-amino-3-methylbutanoate |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](OC(=O)C(N)C(C)C)C=C[C@@]31CCN(C)C2 |
| InChI | InChI=1S/C22H30N2O4/c1-13(2)19(23)21(25)27-15-7-8-22-9-10-24(3)12-14-5-6-16(26-4)20(18(14)22)28-17(22)11-15/h5-8,13,15,17,19H,9-12,23H2,1-4H3/t15-,17-,19?,22-/m0/s1 |
| InChIKey | NXQVMMRTTLXZMU-YNRPBLHXSA-N |
| XLogP | 2.38 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|