C23H33BN2O5 — CID 58235497
N-[(2R)-1-[[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]oxy]-3-methyl-1-oxobutan-2-yl]-methylboronamidic acid (PubChem CID 58235497) has the molecular formula C23H33BN2O5 and a molecular weight of 428.34 g/mol. Its IUPAC name is N-[(2R)-1-[[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]oxy]-3-methyl-1-oxobutan-2-yl]-methylboronamidic acid.
| Compound Name | N-[(2R)-1-[[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]oxy]-3-methyl-1-oxobutan-2-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 58235497 |
| Molecular Formula | C23H33BN2O5 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-[(2R)-1-[[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]oxy]-3-methyl-1-oxobutan-2-yl]-methylboronamidic acid |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](OC(=O)[C@H](NB(C)O)C(C)C)C=C[C@@]31CCN(C)C2 |
| InChI | InChI=1S/C23H33BN2O5/c1-14(2)20(25-24(3)28)22(27)30-16-8-9-23-10-11-26(4)13-15-6-7-17(29-5)21(19(15)23)31-18(23)12-16/h6-9,14,16,18,20,25,28H,10-13H2,1-5H3/t16-,18-,20+,23-/m0/s1 |
| InChIKey | SPZFGTBMBWUGDI-RHQHVJKBSA-N |
| XLogP | 2.13 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|