C27H35NO7 — CID 58235459
(2S)-7-[[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]oxy]-4,7-dioxo-2-propan-2-ylheptanoic acid (PubChem CID 58235459) has the molecular formula C27H35NO7 and a molecular weight of 485.58 g/mol. Its IUPAC name is (2S)-7-[[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]oxy]-4,7-dioxo-2-propan-2-ylheptanoic acid.
| Compound Name | (2S)-7-[[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]oxy]-4,7-dioxo-2-propan-2-ylheptanoic acid |
|---|---|
| PubChem CID | 58235459 |
| Molecular Formula | C27H35NO7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | (2S)-7-[[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl]oxy]-4,7-dioxo-2-propan-2-ylheptanoic acid |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](OC(=O)CCC(=O)C[C@H](C(=O)O)C(C)C)C=C[C@@]31CCN(C)C2 |
| InChI | InChI=1S/C27H35NO7/c1-16(2)20(26(31)32)13-18(29)6-8-23(30)34-19-9-10-27-11-12-28(3)15-17-5-7-21(33-4)25(24(17)27)35-22(27)14-19/h5,7,9-10,16,19-20,22H,6,8,11-15H2,1-4H3,(H,31,32)/t19-,20-,22-,27-/m0/s1 |
| InChIKey | FVNIEWIDIAQYAB-KIJKCAHBSA-N |
| XLogP | 3.50 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|