C39H51NO4 — CID 16666594
[(12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (4E,7E,10E,13E,16E,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 16666594) has the molecular formula C39H51NO4 and a molecular weight of 597.84 g/mol. Its IUPAC name is [(12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (4E,7E,10E,13E,16E,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (4E,7E,10E,13E,16E,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 16666594 |
| Molecular Formula | C39H51NO4 |
| Molecular Weight | 597.84 g/mol |
| Exact Mass | 597.38 |
| IUPAC Name | [(12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (4E,7E,10E,13E,16E,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)O[C@H]1C=CC23CCN(C)Cc4ccc(OC)c(c42)O[C@H]3C1 |
| InChI | InChI=1S/C39H51NO4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-36(41)43-33-26-27-39-28-29-40(2)31-32-24-25-34(42-3)38(37(32)39)44-35(39)30-33/h5-6,8-9,11-12,14-15,17-18,20-21,24-27,33,35H,4,7,10,13,16,19,22-23,28-31H2,1-3H3/b6-5-,9-8+,12-11+,15-14+,18-17+,21-20+/t33-,35-,39?/m0/s1 |
| InChIKey | YJJPJMIYXOAYGR-YLBBDZQISA-N |
| XLogP | 8.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.84 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|