C26H35NO6 — CID 58235480
5-O-tert-butyl 1-O-[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] pentanedioate (PubChem CID 58235480) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] pentanedioate |
|---|---|
| PubChem CID | 58235480 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 5-O-tert-butyl 1-O-[(1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] pentanedioate |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](OC(=O)CCCC(=O)OC(C)(C)C)C=C[C@@]31CCN(C)C2 |
| InChI | InChI=1S/C26H35NO6/c1-25(2,3)33-22(29)8-6-7-21(28)31-18-11-12-26-13-14-27(4)16-17-9-10-19(30-5)24(23(17)26)32-20(26)15-18/h9-12,18,20H,6-8,13-16H2,1-5H3/t18-,20-,26-/m0/s1 |
| InChIKey | QOMQIROBIFWCGV-GCOVDLRRSA-N |
| XLogP | 3.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|