C20H25NO4 — CID 10936841
9'-methoxy-4,4'-dimethylspiro[1,3-dioxolane-2,14'-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene] (PubChem CID 10936841) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 9'-methoxy-4,4'-dimethylspiro[1,3-dioxolane-2,14'-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene].
| Compound Name | 9'-methoxy-4,4'-dimethylspiro[1,3-dioxolane-2,14'-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene] |
|---|---|
| PubChem CID | 10936841 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 9'-methoxy-4,4'-dimethylspiro[1,3-dioxolane-2,14'-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene] |
| SMILES | COc1ccc2c3c1OC1CC4(C=CC31CCN(C)C2)OCC(C)O4 |
| InChI | InChI=1S/C20H25NO4/c1-13-12-23-20(25-13)7-6-19-8-9-21(2)11-14-4-5-15(22-3)18(17(14)19)24-16(19)10-20/h4-7,13,16H,8-12H2,1-3H3 |
| InChIKey | IWVWTRNSGFWTJA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|