C20H21NO6 — CID 59883911
(4S)-9'-methoxy-4-methyl-5'-oxospiro[1,3-dioxolane-2,14'-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene]-4'-carbaldehyde (PubChem CID 59883911) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is (4S)-9'-methoxy-4-methyl-5'-oxospiro[1,3-dioxolane-2,14'-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene]-4'-carbaldehyde.
| Compound Name | (4S)-9'-methoxy-4-methyl-5'-oxospiro[1,3-dioxolane-2,14'-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene]-4'-carbaldehyde |
|---|---|
| PubChem CID | 59883911 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (4S)-9'-methoxy-4-methyl-5'-oxospiro[1,3-dioxolane-2,14'-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene]-4'-carbaldehyde |
| SMILES | COc1ccc2c3c1OC1CC4(C=CC31CCN(C=O)C2=O)OC[C@H](C)O4 |
| InChI | InChI=1S/C20H21NO6/c1-12-10-25-20(27-12)6-5-19-7-8-21(11-22)18(23)13-3-4-14(24-2)17(16(13)19)26-15(19)9-20/h3-6,11-12,15H,7-10H2,1-2H3/t12-,15?,19?,20?/m0/s1 |
| InChIKey | FVPFFNQPUITBGI-TXIZTYFOSA-N |
| XLogP | 1.79 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|