C21H29I2NO3 — CID 162264568
ethane;9-methoxy-4,5-dimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-14-carbaldehyde;molecular iodine (PubChem CID 162264568) has the molecular formula C21H29I2NO3 and a molecular weight of 597.28 g/mol. Its IUPAC name is ethane;9-methoxy-4,5-dimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-14-carbaldehyde;molecular iodine.
| Compound Name | ethane;9-methoxy-4,5-dimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-14-carbaldehyde;molecular iodine |
|---|---|
| PubChem CID | 162264568 |
| Molecular Formula | C21H29I2NO3 |
| Molecular Weight | 597.28 g/mol |
| Exact Mass | 597.02 |
| IUPAC Name | ethane;9-methoxy-4,5-dimethyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-14-carbaldehyde;molecular iodine |
| SMILES | CC.COc1ccc2c3c1OC1CC(C=O)C=CC31CCN(C)C2C.II |
| InChI | InChI=1S/C19H23NO3.C2H6.I2/c1-12-14-4-5-15(22-3)18-17(14)19(8-9-20(12)2)7-6-13(11-21)10-16(19)23-18;2*1-2/h4-7,11-13,16H,8-10H2,1-3H3;1-2H3; |
| InChIKey | ZZSKARGBTMAHFA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.28 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|