C27H29NO5 — CID 98474867
(1R,2S,9S,10R)-4,7,15,16-tetramethoxy-20-methyl-20-azahexacyclo[8.7.3.32,9.01,9.03,8.012,17]tricosa-3,5,7,12(17),13,15,21-heptaen-23-one (PubChem CID 98474867) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is (1R,2S,9S,10R)-4,7,15,16-tetramethoxy-20-methyl-20-azahexacyclo[8.7.3.32,9.01,9.03,8.012,17]tricosa-3,5,7,12(17),13,15,21-heptaen-23-one.
| Compound Name | (1R,2S,9S,10R)-4,7,15,16-tetramethoxy-20-methyl-20-azahexacyclo[8.7.3.32,9.01,9.03,8.012,17]tricosa-3,5,7,12(17),13,15,21-heptaen-23-one |
|---|---|
| PubChem CID | 98474867 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (1R,2S,9S,10R)-4,7,15,16-tetramethoxy-20-methyl-20-azahexacyclo[8.7.3.32,9.01,9.03,8.012,17]tricosa-3,5,7,12(17),13,15,21-heptaen-23-one |
| SMILES | COc1ccc2c(c1OC)[C@@]13CCN(C)[C@H](C2)[C@@]12C=CC(=O)[C@@H]3c1c(OC)ccc(OC)c12 |
| InChI | InChI=1S/C27H29NO5/c1-28-13-12-27-22-15(6-7-19(32-4)25(22)33-5)14-20(28)26(27)11-10-16(29)23(27)21-17(30-2)8-9-18(31-3)24(21)26/h6-11,20,23H,12-14H2,1-5H3/t20-,23-,26-,27-/m1/s1 |
| InChIKey | DQTBOURYFPQWFJ-CYPYXQILSA-N |
| XLogP | 3.39 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |