C22H31NO4 — CID 68541114
(1R,9R,10S)-10-ethoxy-3,4-dimethoxy-14,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 68541114) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (1R,9R,10S)-10-ethoxy-3,4-dimethoxy-14,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1R,9R,10S)-10-ethoxy-3,4-dimethoxy-14,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 68541114 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (1R,9R,10S)-10-ethoxy-3,4-dimethoxy-14,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | CCO[C@@]12CCC(=O)C(C)[C@@]13CCN(C)[C@@H]2Cc1ccc(OC)c(OC)c13 |
| InChI | InChI=1S/C22H31NO4/c1-6-27-22-10-9-16(24)14(2)21(22)11-12-23(3)18(22)13-15-7-8-17(25-4)20(26-5)19(15)21/h7-8,14,18H,6,9-13H2,1-5H3/t14?,18-,21-,22-/m1/s1 |
| InChIKey | LCBGIGDSRFMRBB-JRNADJLJSA-N |
| XLogP | 2.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |