C36H40N2O12S — CID 90025535
bis((4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one);sulfuric acid (PubChem CID 90025535) has the molecular formula C36H40N2O12S and a molecular weight of 724.79 g/mol. Its IUPAC name is bis((4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one);sulfuric acid.
| Compound Name | bis((4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one);sulfuric acid |
|---|---|
| PubChem CID | 90025535 |
| Molecular Formula | C36H40N2O12S |
| Molecular Weight | 724.79 g/mol |
| Exact Mass | 724.23 |
| IUPAC Name | bis((4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one);sulfuric acid |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)C=C[C@@]4(O)[C@@H](C2)N(C)CC[C@]314.COc1ccc2c3c1O[C@H]1C(=O)C=C[C@@]4(O)[C@@H](C2)N(C)CC[C@]314.O=S(=O)(O)O |
| InChI | InChI=1S/2C18H19NO4.H2O4S/c2*1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10;1-5(2,3)4/h2*3-6,13,16,21H,7-9H2,1-2H3;(H2,1,2,3,4)/t2*13-,16+,17+,18-;/m11./s1 |
| InChIKey | UEVFEOWRBXXYNU-KDKWOIFOSA-N |
| XLogP | 1.00 |
| TPSA | 192.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.79 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|