C18H18O4 — CID 134454196
(1S,5R,13R)-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one (PubChem CID 134454196) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is (1S,5R,13R)-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one.
| Compound Name | (1S,5R,13R)-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one |
|---|---|
| PubChem CID | 134454196 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1S,5R,13R)-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)C=CC4(O)[C@H](CCC[C@]314)C2 |
| InChI | InChI=1S/C18H18O4/c1-21-13-5-4-10-9-11-3-2-7-17-14(10)15(13)22-16(17)12(19)6-8-18(11,17)20/h4-6,8,11,16,20H,2-3,7,9H2,1H3/t11-,16+,17+,18?/m1/s1 |
| InChIKey | IYUUWHBJEAJTGR-PQVNZPGQSA-N |
| XLogP | 1.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |