C18H19NO4 — CID 118370688
(1S,5S,13R,17R)-4-amino-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one (PubChem CID 118370688) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (1S,5S,13R,17R)-4-amino-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one.
| Compound Name | (1S,5S,13R,17R)-4-amino-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one |
|---|---|
| PubChem CID | 118370688 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (1S,5S,13R,17R)-4-amino-17-hydroxy-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)C=C[C@@]4(O)[C@@H](C2)C(N)CC[C@]314 |
| InChI | InChI=1S/C18H19NO4/c1-22-13-3-2-9-8-10-11(19)4-6-17-14(9)15(13)23-16(17)12(20)5-7-18(10,17)21/h2-3,5,7,10-11,16,21H,4,6,8,19H2,1H3/t10-,11?,16-,17-,18+/m0/s1 |
| InChIKey | CPTVHXPFLAGRMG-VCJHVUSMSA-N |
| XLogP | 0.86 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |