C19H20O4 — CID 163418907
(5R,13R,17S)-10,17-dimethoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one (PubChem CID 163418907) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (5R,13R,17S)-10,17-dimethoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one.
| Compound Name | (5R,13R,17S)-10,17-dimethoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one |
|---|---|
| PubChem CID | 163418907 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (5R,13R,17S)-10,17-dimethoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)C=C[C@@]4(OC)[C@H](CCCC314)C2 |
| InChI | InChI=1S/C19H20O4/c1-21-14-6-5-11-10-12-4-3-8-18-15(11)16(14)23-17(18)13(20)7-9-19(12,18)22-2/h5-7,9,12,17H,3-4,8,10H2,1-2H3/t12-,17+,18?,19-/m1/s1 |
| InChIKey | AGTTWMRVLJLMMR-ZJUSBEFVSA-N |
| XLogP | 2.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |