C23H26O4 — CID 118983515
(1R,2S,6R,14R,15R,16R)-11,15-dimethoxy-16-methyl-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbaldehyde (PubChem CID 118983515) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is (1R,2S,6R,14R,15R,16R)-11,15-dimethoxy-16-methyl-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbaldehyde.
| Compound Name | (1R,2S,6R,14R,15R,16R)-11,15-dimethoxy-16-methyl-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbaldehyde |
|---|---|
| PubChem CID | 118983515 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (1R,2S,6R,14R,15R,16R)-11,15-dimethoxy-16-methyl-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbaldehyde |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)C=C[C@@]5(C[C@@]4(C)C=O)[C@H](CCC[C@]315)C2 |
| InChI | InChI=1S/C23H26O4/c1-20(13-24)12-21-9-10-23(20,26-3)19-22(21)8-4-5-15(21)11-14-6-7-16(25-2)18(27-19)17(14)22/h6-7,9-10,13,15,19H,4-5,8,11-12H2,1-3H3/t15-,19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | VPRWBOLLWTVDRY-WIYYMVNJSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|