C21H22N2O6 — CID 98105619
(1R,2S,6S,14S,15R,19S)-11,15-dimethoxy-19-nitro-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene-5-carbaldehyde (PubChem CID 98105619) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is (1R,2S,6S,14S,15R,19S)-11,15-dimethoxy-19-nitro-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene-5-carbaldehyde.
| Compound Name | (1R,2S,6S,14S,15R,19S)-11,15-dimethoxy-19-nitro-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene-5-carbaldehyde |
|---|---|
| PubChem CID | 98105619 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (1R,2S,6S,14S,15R,19S)-11,15-dimethoxy-19-nitro-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene-5-carbaldehyde |
| SMILES | COc1ccc2c3c1O[C@@H]1[C@@]4(OC)C=C[C@@]5(C[C@@H]4[N+](=O)[O-])[C@H](C2)N(C=O)CC[C@]315 |
| InChI | InChI=1S/C21H22N2O6/c1-27-13-4-3-12-9-14-19-5-6-21(28-2,15(10-19)23(25)26)18-20(19,7-8-22(14)11-24)16(12)17(13)29-18/h3-6,11,14-15,18H,7-10H2,1-2H3/t14-,15-,18-,19+,20-,21+/m0/s1 |
| InChIKey | HPDRZNAVNJHXRU-ADUPISGUSA-N |
| XLogP | 1.47 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|