C23H26O3 — CID 170293685
1-[(1R,2S,6R,14R,15R,16S)-15-methoxy-11-methyl-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]ethanone (PubChem CID 170293685) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[(1R,2S,6R,14R,15R,16S)-15-methoxy-11-methyl-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]ethanone.
| Compound Name | 1-[(1R,2S,6R,14R,15R,16S)-15-methoxy-11-methyl-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]ethanone |
|---|---|
| PubChem CID | 170293685 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 1-[(1R,2S,6R,14R,15R,16S)-15-methoxy-11-methyl-13-oxahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]ethanone |
| SMILES | CO[C@]12C=C[C@@]3(C[C@@H]1C(C)=O)[C@@H]1CCC[C@@]34c3c(ccc(C)c3O[C@@H]24)C1 |
| InChI | InChI=1S/C23H26O3/c1-13-6-7-15-11-16-5-4-8-22-18(15)19(13)26-20(22)23(25-3)10-9-21(16,22)12-17(23)14(2)24/h6-7,9-10,16-17,20H,4-5,8,11-12H2,1-3H3/t16-,17-,20-,21-,22+,23-/m1/s1 |
| InChIKey | DBEPNNOGJVPLOI-MKRRVUFQSA-N |
| XLogP | 3.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|