C38H60NO12P — CID 154728271
[(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate (PubChem CID 154728271) has the molecular formula C38H60NO12P and a molecular weight of 753.87 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate.
| Compound Name | [(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 154728271 |
| Molecular Formula | C38H60NO12P |
| Molecular Weight | 753.87 g/mol |
| Exact Mass | 753.39 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] 2-[2-[2-[2-(2-decoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate |
| SMILES | CCCCCCCCCCOCCOCCOCCOCCOCCOP(=O)(O)O[C@@]12C=CC(=O)[C@@H]3Oc4c(OC)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C38H60NO12P/c1-4-5-6-7-8-9-10-11-18-44-19-20-45-21-22-46-23-24-47-25-26-48-27-28-49-52(41,42)51-38-15-14-31(40)36-37(38)16-17-39(2)33(38)29-30-12-13-32(43-3)35(50-36)34(30)37/h12-15,33,36H,4-11,16-29H2,1-3H3,(H,41,42)/t33-,36+,37+,38-/m1/s1 |
| InChIKey | KRQHGNQQPWOSIL-ZESHPCRNSA-N |
| XLogP | 5.19 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|