C16H16O4 — CID 129234880
(5S,14S)-5-hydroxy-11-methoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one (PubChem CID 129234880) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (5S,14S)-5-hydroxy-11-methoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one.
| Compound Name | (5S,14S)-5-hydroxy-11-methoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one |
|---|---|
| PubChem CID | 129234880 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (5S,14S)-5-hydroxy-11-methoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one |
| SMILES | COc1ccc2c3c1OC1C(=O)C=C[C@@](O)(CC2)[C@@]31C |
| InChI | InChI=1S/C16H16O4/c1-15-12-9-3-4-11(19-2)13(12)20-14(15)10(17)6-8-16(15,18)7-5-9/h3-4,6,8,14,18H,5,7H2,1-2H3/t14?,15-,16-/m0/s1 |
| InChIKey | GKBUEJNYVHPKFN-YVZMLIKISA-N |
| XLogP | 1.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |