C17H17NO4 — CID 129234813
(1S,5R,6S,10R)-6-hydroxy-13-methoxy-4-methyl-11-oxa-4-azahexacyclo[8.7.0.01,6.03,5.03,16.012,17]heptadeca-12,14,16-trien-9-one (PubChem CID 129234813) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (1S,5R,6S,10R)-6-hydroxy-13-methoxy-4-methyl-11-oxa-4-azahexacyclo[8.7.0.01,6.03,5.03,16.012,17]heptadeca-12,14,16-trien-9-one.
| Compound Name | (1S,5R,6S,10R)-6-hydroxy-13-methoxy-4-methyl-11-oxa-4-azahexacyclo[8.7.0.01,6.03,5.03,16.012,17]heptadeca-12,14,16-trien-9-one |
|---|---|
| PubChem CID | 129234813 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (1S,5R,6S,10R)-6-hydroxy-13-methoxy-4-methyl-11-oxa-4-azahexacyclo[8.7.0.01,6.03,5.03,16.012,17]heptadeca-12,14,16-trien-9-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H]5N(C)C25C[C@]314 |
| InChI | InChI=1S/C17H17NO4/c1-18-14-16(18)7-15-11-8(16)3-4-10(21-2)12(11)22-13(15)9(19)5-6-17(14,15)20/h3-4,13-14,20H,5-7H2,1-2H3/t13-,14+,15-,16?,17+,18?/m0/s1 |
| InChIKey | YZFXKABXVCGRBX-JNTJZFBISA-N |
| XLogP | 0.71 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|