C18H21NO5 — CID 139025660
(4R,4aS,7aR,12bS)-4a,13-dihydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 139025660) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-4a,13-dihydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,7aR,12bS)-4a,13-dihydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 139025660 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (4R,4aS,7aR,12bS)-4a,13-dihydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2O)N(C)CC[C@]314 |
| InChI | InChI=1S/C18H21NO5/c1-19-8-7-17-12-9-3-4-11(23-2)14(12)24-16(17)10(20)5-6-18(17,22)15(19)13(9)21/h3-4,13,15-16,21-22H,5-8H2,1-2H3/t13?,15-,16+,17+,18-/m1/s1 |
| InChIKey | SXHURKJPBYEAQN-NFEUPGRZSA-N |
| XLogP | 0.54 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |