C18H21NO4 — CID 155083905
(1S,11R,15S)-15-hydroxy-8-methoxy-15-methyl-3-methylimino-10-oxatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8-trien-12-one (PubChem CID 155083905) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (1S,11R,15S)-15-hydroxy-8-methoxy-15-methyl-3-methylimino-10-oxatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8-trien-12-one.
| Compound Name | (1S,11R,15S)-15-hydroxy-8-methoxy-15-methyl-3-methylimino-10-oxatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8-trien-12-one |
|---|---|
| PubChem CID | 155083905 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (1S,11R,15S)-15-hydroxy-8-methoxy-15-methyl-3-methylimino-10-oxatetracyclo[7.6.1.01,11.05,16]hexadeca-5(16),6,8-trien-12-one |
| SMILES | C/N=C1\Cc2ccc(OC)c3c2[C@@]2(C1)[C@@H](O3)C(=O)CC[C@]2(C)O |
| InChI | InChI=1S/C18H21NO4/c1-17(21)7-6-12(20)16-18(17)9-11(19-2)8-10-4-5-13(22-3)15(23-16)14(10)18/h4-5,16,21H,6-9H2,1-3H3/b19-11+/t16-,17-,18-/m0/s1 |
| InChIKey | FWULGFUUULOFIO-CKSBNFNSSA-N |
| XLogP | 1.82 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|