C19H20BrNO3 — CID 124902167
(4R,4aS,7aS,12bS)-4a-bromo-9-methoxy-3,7a-dimethyl-1,2,4,13-tetrahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 124902167) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is (4R,4aS,7aS,12bS)-4a-bromo-9-methoxy-3,7a-dimethyl-1,2,4,13-tetrahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,7aS,12bS)-4a-bromo-9-methoxy-3,7a-dimethyl-1,2,4,13-tetrahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 124902167 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (4R,4aS,7aS,12bS)-4a-bromo-9-methoxy-3,7a-dimethyl-1,2,4,13-tetrahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1ccc2c3c1O[C@]1(C)C(=O)C=C[C@@]4(Br)[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C19H20BrNO3/c1-17-14(22)6-7-19(20)13-10-11-4-5-12(23-3)16(24-17)15(11)18(17,19)8-9-21(13)2/h4-7,13H,8-10H2,1-3H3/t13-,17-,18+,19-/m1/s1 |
| InChIKey | PCGGWLLGERNERR-CODKJTEISA-N |
| XLogP | 2.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|