C21H27NO4 — CID 54533281
(1R,14R)-5,11-dimethoxy-1-methyl-6-(methylamino)-14-propyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one (PubChem CID 54533281) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (1R,14R)-5,11-dimethoxy-1-methyl-6-(methylamino)-14-propyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one.
| Compound Name | (1R,14R)-5,11-dimethoxy-1-methyl-6-(methylamino)-14-propyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one |
|---|---|
| PubChem CID | 54533281 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (1R,14R)-5,11-dimethoxy-1-methyl-6-(methylamino)-14-propyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one |
| SMILES | CCC[C@]12c3c4ccc(OC)c3O[C@@]1(C)C(=O)C=CC2(OC)C(NC)C4 |
| InChI | InChI=1S/C21H27NO4/c1-6-10-20-17-13-7-8-14(24-4)18(17)26-19(20,2)16(23)9-11-21(20,25-5)15(12-13)22-3/h7-9,11,15,22H,6,10,12H2,1-5H3/t15?,19-,20-,21?/m0/s1 |
| InChIKey | YYAMFDHZVXIEFP-IJXDTGRPSA-N |
| XLogP | 2.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |