C17H23NO3 — CID 134525959
(1R,5R,6S)-11-methoxy-14-methyl-6-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-ol (PubChem CID 134525959) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (1R,5R,6S)-11-methoxy-14-methyl-6-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-ol.
| Compound Name | (1R,5R,6S)-11-methoxy-14-methyl-6-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-ol |
|---|---|
| PubChem CID | 134525959 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (1R,5R,6S)-11-methoxy-14-methyl-6-(methylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-ol |
| SMILES | CN[C@H]1Cc2ccc(OC)c3c2C2(C)[C@@H](CCC[C@]12O)O3 |
| InChI | InChI=1S/C17H23NO3/c1-16-13-5-4-8-17(16,19)12(18-2)9-10-6-7-11(20-3)15(21-13)14(10)16/h6-7,12-13,18-19H,4-5,8-9H2,1-3H3/t12-,13+,16?,17-/m0/s1 |
| InChIKey | HMDKTAPBYFGZLZ-BHZYAJLCSA-N |
| XLogP | 1.77 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |